C16H16N2O6 — CID 135341101
2-(benzylamino)-3-(3,4-dihydroxy-2-nitrophenyl)propanoic acid (PubChem CID 135341101) has the molecular formula C16H16N2O6 and a molecular weight of 332.31 g/mol. Its IUPAC name is 2-(benzylamino)-3-(3,4-dihydroxy-2-nitrophenyl)propanoic acid.
| Compound Name | 2-(benzylamino)-3-(3,4-dihydroxy-2-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 135341101 |
| Molecular Formula | C16H16N2O6 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 2-(benzylamino)-3-(3,4-dihydroxy-2-nitrophenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(O)c(O)c1[N+](=O)[O-])NCc1ccccc1 |
| InChI | InChI=1S/C16H16N2O6/c19-13-7-6-11(14(15(13)20)18(23)24)8-12(16(21)22)17-9-10-4-2-1-3-5-10/h1-7,12,17,19-20H,8-9H2,(H,21,22) |
| InChIKey | ZOJOUUIBZHNHPB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 132.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|