C13H20N6O3 — CID 66741800
(2S)-4-[[amino(nitramido)methylidene]amino]-2-(benzylamino)pentanamide (PubChem CID 66741800) has the molecular formula C13H20N6O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is (2S)-4-[[amino(nitramido)methylidene]amino]-2-(benzylamino)pentanamide.
| Compound Name | (2S)-4-[[amino(nitramido)methylidene]amino]-2-(benzylamino)pentanamide |
|---|---|
| PubChem CID | 66741800 |
| Molecular Formula | C13H20N6O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (2S)-4-[[amino(nitramido)methylidene]amino]-2-(benzylamino)pentanamide |
| SMILES | CC(C[C@H](NCc1ccccc1)C(N)=O)/N=C(\N)N[N+](=O)[O-] |
| InChI | InChI=1S/C13H20N6O3/c1-9(17-13(15)18-19(21)22)7-11(12(14)20)16-8-10-5-3-2-4-6-10/h2-6,9,11,16H,7-8H2,1H3,(H2,14,20)(H3,15,17,18)/t9?,11-/m0/s1 |
| InChIKey | PBDFOKBQCPHDER-UMJHXOGRSA-N |
| XLogP | -0.50 |
| TPSA | 148.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|