C9H20N4O2 — CID 22840792
ethyl (2R)-2-amino-5-(diaminomethylideneamino)-4-methylpentanoate (PubChem CID 22840792) has the molecular formula C9H20N4O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is ethyl (2R)-2-amino-5-(diaminomethylideneamino)-4-methylpentanoate.
| Compound Name | ethyl (2R)-2-amino-5-(diaminomethylideneamino)-4-methylpentanoate |
|---|---|
| PubChem CID | 22840792 |
| Molecular Formula | C9H20N4O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | ethyl (2R)-2-amino-5-(diaminomethylideneamino)-4-methylpentanoate |
| SMILES | CCOC(=O)[C@H](N)CC(C)CN=C(N)N |
| InChI | InChI=1S/C9H20N4O2/c1-3-15-8(14)7(10)4-6(2)5-13-9(11)12/h6-7H,3-5,10H2,1-2H3,(H4,11,12,13)/t6?,7-/m1/s1 |
| InChIKey | YZDHQCZAFMZHQL-COBSHVIPSA-N |
| XLogP | -0.82 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|