C8H16N4O3 — CID 87499595
(2S)-2-amino-4-[(diaminomethylideneamino)methyl]-5-oxohexanoic acid (PubChem CID 87499595) has the molecular formula C8H16N4O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is (2S)-2-amino-4-[(diaminomethylideneamino)methyl]-5-oxohexanoic acid.
| Compound Name | (2S)-2-amino-4-[(diaminomethylideneamino)methyl]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 87499595 |
| Molecular Formula | C8H16N4O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (2S)-2-amino-4-[(diaminomethylideneamino)methyl]-5-oxohexanoic acid |
| SMILES | CC(=O)C(CN=C(N)N)C[C@H](N)C(=O)O |
| InChI | InChI=1S/C8H16N4O3/c1-4(13)5(3-12-8(10)11)2-6(9)7(14)15/h5-6H,2-3,9H2,1H3,(H,14,15)(H4,10,11,12)/t5?,6-/m0/s1 |
| InChIKey | BFLKIYNAWMVSDY-GDVGLLTNSA-N |
| XLogP | -1.73 |
| TPSA | 144.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|