C12H18N4O3 — CID 70071233
(2S)-2-amino-5-(diaminomethylideneamino)-4-phenoxypentanoic acid (PubChem CID 70071233) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)-4-phenoxypentanoic acid.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)-4-phenoxypentanoic acid |
|---|---|
| PubChem CID | 70071233 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)-4-phenoxypentanoic acid |
| SMILES | NC(N)=NCC(C[C@H](N)C(=O)O)Oc1ccccc1 |
| InChI | InChI=1S/C12H18N4O3/c13-10(11(17)18)6-9(7-16-12(14)15)19-8-4-2-1-3-5-8/h1-5,9-10H,6-7,13H2,(H,17,18)(H4,14,15,16)/t9?,10-/m0/s1 |
| InChIKey | WYXJRRCNKQQVSV-AXDSSHIGSA-N |
| XLogP | -0.49 |
| TPSA | 136.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|