C4H11N5O — CID 149104160
(2S)-2-amino-3-(diaminomethylideneamino)propanamide (PubChem CID 149104160) has the molecular formula C4H11N5O and a molecular weight of 145.17 g/mol. Its IUPAC name is (2S)-2-amino-3-(diaminomethylideneamino)propanamide.
| Compound Name | (2S)-2-amino-3-(diaminomethylideneamino)propanamide |
|---|---|
| PubChem CID | 149104160 |
| Molecular Formula | C4H11N5O |
| Molecular Weight | 145.17 g/mol |
| Exact Mass | 145.10 |
| IUPAC Name | (2S)-2-amino-3-(diaminomethylideneamino)propanamide |
| SMILES | NC(=O)[C@@H](N)CN=C(N)N |
| InChI | InChI=1S/C4H11N5O/c5-2(3(6)10)1-9-4(7)8/h2H,1,5H2,(H2,6,10)(H4,7,8,9)/t2-/m0/s1 |
| InChIKey | QVICPIQAGDAJBX-REOHCLBHSA-N |
| XLogP | -2.93 |
| TPSA | 133.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.17 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|