C10H20N8O — CID 91171978
(2S)-2-amino-4-[(diaminomethylideneamino)methyl]-6-(2H-triazol-4-yl)hexanamide (PubChem CID 91171978) has the molecular formula C10H20N8O and a molecular weight of 268.32 g/mol. Its IUPAC name is (2S)-2-amino-4-[(diaminomethylideneamino)methyl]-6-(2H-triazol-4-yl)hexanamide.
| Compound Name | (2S)-2-amino-4-[(diaminomethylideneamino)methyl]-6-(2H-triazol-4-yl)hexanamide |
|---|---|
| PubChem CID | 91171978 |
| Molecular Formula | C10H20N8O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | (2S)-2-amino-4-[(diaminomethylideneamino)methyl]-6-(2H-triazol-4-yl)hexanamide |
| SMILES | NC(=O)[C@@H](N)CC(CCc1cn[nH]n1)CN=C(N)N |
| InChI | InChI=1S/C10H20N8O/c11-8(9(12)19)3-6(4-15-10(13)14)1-2-7-5-16-18-17-7/h5-6,8H,1-4,11H2,(H2,12,19)(H4,13,14,15)(H,16,17,18)/t6?,8-/m0/s1 |
| InChIKey | AHIYYCCIHLAKAZ-XDKWHASVSA-N |
| XLogP | -2.17 |
| TPSA | 175.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|