C10H20N4O2 — CID 46700879
(E)-2-amino-7-(diaminomethylideneamino)-4,5-dimethylhept-4-enoic acid (PubChem CID 46700879) has the molecular formula C10H20N4O2 and a molecular weight of 228.30 g/mol. Its IUPAC name is (E)-2-amino-7-(diaminomethylideneamino)-4,5-dimethylhept-4-enoic acid.
| Compound Name | (E)-2-amino-7-(diaminomethylideneamino)-4,5-dimethylhept-4-enoic acid |
|---|---|
| PubChem CID | 46700879 |
| Molecular Formula | C10H20N4O2 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | (E)-2-amino-7-(diaminomethylideneamino)-4,5-dimethylhept-4-enoic acid |
| SMILES | C/C(CCN=C(N)N)=C(/C)CC(N)C(=O)O |
| InChI | InChI=1S/C10H20N4O2/c1-6(3-4-14-10(12)13)7(2)5-8(11)9(15)16/h8H,3-5,11H2,1-2H3,(H,15,16)(H4,12,13,14)/b7-6+ |
| InChIKey | MUXISWBCYJTFKU-VOTSOKGWSA-N |
| XLogP | -0.21 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|