C10H21N3O2 — CID 162252165
2-[(diaminomethylideneamino)methyl]-5,5-dimethylhexanoic acid (PubChem CID 162252165) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-[(diaminomethylideneamino)methyl]-5,5-dimethylhexanoic acid.
| Compound Name | 2-[(diaminomethylideneamino)methyl]-5,5-dimethylhexanoic acid |
|---|---|
| PubChem CID | 162252165 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | 2-[(diaminomethylideneamino)methyl]-5,5-dimethylhexanoic acid |
| SMILES | CC(C)(C)CCC(CN=C(N)N)C(=O)O |
| InChI | InChI=1S/C10H21N3O2/c1-10(2,3)5-4-7(8(14)15)6-13-9(11)12/h7H,4-6H2,1-3H3,(H,14,15)(H4,11,12,13) |
| InChIKey | WJORYEKLNCSXPM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|