C12H27N3 — CID 90242870
2-(2-tert-butyl-4,4-dimethylpentyl)guanidine (PubChem CID 90242870) has the molecular formula C12H27N3 and a molecular weight of 213.37 g/mol. Its IUPAC name is 2-(2-tert-butyl-4,4-dimethylpentyl)guanidine.
| Compound Name | 2-(2-tert-butyl-4,4-dimethylpentyl)guanidine |
|---|---|
| PubChem CID | 90242870 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | 2-(2-tert-butyl-4,4-dimethylpentyl)guanidine |
| SMILES | CC(C)(C)CC(CN=C(N)N)C(C)(C)C |
| InChI | InChI=1S/C12H27N3/c1-11(2,3)7-9(12(4,5)6)8-15-10(13)14/h9H,7-8H2,1-6H3,(H4,13,14,15) |
| InChIKey | BNKIUFYCVFNFAJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|