2-(aminomethyl)-5,5-dimethylheptanoic acid

C10H21NO2 — CID 87760218

IUPAC2-(aminomethyl)-5,5-dimethylheptanoic acid
SMILESCCC(C)(C)CCC(CN)C(=O)O
InChIInChI=1S/C10H21NO2/c1-4-10(2,3)6-5-8(7-11)9(12)13/h8H,4-7,11H2,1-3H3,(H,12,13)
InChIKeyVCUKEYOGCZUMOR-UHFFFAOYSA-N
MW187.28 g/mol
LogP1.86
Rot. Bonds6

About 2-(aminomethyl)-5,5-dimethylheptanoic acid

2-(aminomethyl)-5,5-dimethylheptanoic acid (PubChem CID 87760218) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is 2-(aminomethyl)-5,5-dimethylheptanoic acid.

Molecular Properties

Compound Name2-(aminomethyl)-5,5-dimethylheptanoic acid
PubChem CID87760218
Molecular FormulaC10H21NO2
Molecular Weight187.28 g/mol
Exact Mass187.16
IUPAC Name2-(aminomethyl)-5,5-dimethylheptanoic acid
SMILESCCC(C)(C)CCC(CN)C(=O)O
InChIInChI=1S/C10H21NO2/c1-4-10(2,3)6-5-8(7-11)9(12)13/h8H,4-7,11H2,1-3H3,(H,12,13)
InChIKeyVCUKEYOGCZUMOR-UHFFFAOYSA-N
XLogP1.86
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.28
LogP ≤ 51.86
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(aminomethyl)-5,5-dimethylheptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(aminomethyl)-5,5-dimethylheptanoic acid?
The IUPAC name of 2-(aminomethyl)-5,5-dimethylheptanoic acid (CID 87760218) is 2-(aminomethyl)-5,5-dimethylheptanoic acid.
What is the SMILES notation for 2-(aminomethyl)-5,5-dimethylheptanoic acid?
The canonical SMILES for 2-(aminomethyl)-5,5-dimethylheptanoic acid is CCC(C)(C)CCC(CN)C(=O)O.
What is the InChIKey of 2-(aminomethyl)-5,5-dimethylheptanoic acid?
The InChIKey is VCUKEYOGCZUMOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO2/c1-4-10(2,3)6-5-8(7-11)9(12)13/h8H,4-7,11H2,1-3H3,(H,12,13).
What are the key properties of 2-(aminomethyl)-5,5-dimethylheptanoic acid?
2-(aminomethyl)-5,5-dimethylheptanoic acid has a molecular weight of 187.28 g/mol, XLogP of 1.86, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-5,5-dimethylheptanoic acid is sourced from PubChem (CID 87760218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).