C20H25NO3S — CID 86943976
N-(3,3-dimethylbutylsulfonyl)-2,2-diphenylacetamide (PubChem CID 86943976) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is N-(3,3-dimethylbutylsulfonyl)-2,2-diphenylacetamide.
| Compound Name | N-(3,3-dimethylbutylsulfonyl)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 86943976 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-(3,3-dimethylbutylsulfonyl)-2,2-diphenylacetamide |
| SMILES | CC(C)(C)CCS(=O)(=O)NC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25NO3S/c1-20(2,3)14-15-25(23,24)21-19(22)18(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,18H,14-15H2,1-3H3,(H,21,22) |
| InChIKey | PUUYMHILCXNWNT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |