C16H25NO3S2 — CID 86943964
N-(3,3-dimethylbutylsulfonyl)-2-phenylsulfanylbutanamide (PubChem CID 86943964) has the molecular formula C16H25NO3S2 and a molecular weight of 343.51 g/mol. Its IUPAC name is N-(3,3-dimethylbutylsulfonyl)-2-phenylsulfanylbutanamide.
| Compound Name | N-(3,3-dimethylbutylsulfonyl)-2-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 86943964 |
| Molecular Formula | C16H25NO3S2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N-(3,3-dimethylbutylsulfonyl)-2-phenylsulfanylbutanamide |
| SMILES | CCC(Sc1ccccc1)C(=O)NS(=O)(=O)CCC(C)(C)C |
| InChI | InChI=1S/C16H25NO3S2/c1-5-14(21-13-9-7-6-8-10-13)15(18)17-22(19,20)12-11-16(2,3)4/h6-10,14H,5,11-12H2,1-4H3,(H,17,18) |
| InChIKey | BPZSMLNQUDJZPA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |