C18H21NO3S — CID 126839834
N-[3,5-bis(hydroxymethyl)phenyl]-2-phenylsulfanylbutanamide (PubChem CID 126839834) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is N-[3,5-bis(hydroxymethyl)phenyl]-2-phenylsulfanylbutanamide.
| Compound Name | N-[3,5-bis(hydroxymethyl)phenyl]-2-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 126839834 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N-[3,5-bis(hydroxymethyl)phenyl]-2-phenylsulfanylbutanamide |
| SMILES | CCC(Sc1ccccc1)C(=O)Nc1cc(CO)cc(CO)c1 |
| InChI | InChI=1S/C18H21NO3S/c1-2-17(23-16-6-4-3-5-7-16)18(22)19-15-9-13(11-20)8-14(10-15)12-21/h3-10,17,20-21H,2,11-12H2,1H3,(H,19,22) |
| InChIKey | BCMUNGVLQAEKQO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |