C18H29NO3S — CID 86943979
N-(3,3-dimethylbutylsulfonyl)-4-methyl-3-phenylpentanamide (PubChem CID 86943979) has the molecular formula C18H29NO3S and a molecular weight of 339.50 g/mol. Its IUPAC name is N-(3,3-dimethylbutylsulfonyl)-4-methyl-3-phenylpentanamide.
| Compound Name | N-(3,3-dimethylbutylsulfonyl)-4-methyl-3-phenylpentanamide |
|---|---|
| PubChem CID | 86943979 |
| Molecular Formula | C18H29NO3S |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | N-(3,3-dimethylbutylsulfonyl)-4-methyl-3-phenylpentanamide |
| SMILES | CC(C)C(CC(=O)NS(=O)(=O)CCC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H29NO3S/c1-14(2)16(15-9-7-6-8-10-15)13-17(20)19-23(21,22)12-11-18(3,4)5/h6-10,14,16H,11-13H2,1-5H3,(H,19,20) |
| InChIKey | LIBCQBSABPDTIQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |