C11H23N3O5S2 — CID 76988697
2-cyclohexyl-N'-hydroxy-2-(2-methylsulfonylethylsulfonylamino)ethanimidamide (PubChem CID 76988697) has the molecular formula C11H23N3O5S2 and a molecular weight of 341.46 g/mol. Its IUPAC name is 2-cyclohexyl-N'-hydroxy-2-(2-methylsulfonylethylsulfonylamino)ethanimidamide.
| Compound Name | 2-cyclohexyl-N'-hydroxy-2-(2-methylsulfonylethylsulfonylamino)ethanimidamide |
|---|---|
| PubChem CID | 76988697 |
| Molecular Formula | C11H23N3O5S2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 2-cyclohexyl-N'-hydroxy-2-(2-methylsulfonylethylsulfonylamino)ethanimidamide |
| SMILES | CS(=O)(=O)CCS(=O)(=O)NC(C(N)=NO)C1CCCCC1 |
| InChI | InChI=1S/C11H23N3O5S2/c1-20(16,17)7-8-21(18,19)14-10(11(12)13-15)9-5-3-2-4-6-9/h9-10,14-15H,2-8H2,1H3,(H2,12,13) |
| InChIKey | QAUJQNJKUVBBRK-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 138.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|