C12H19NO5S — CID 119213913
2-[(2-cyclopentylsulfonylacetyl)amino]-2-cyclopropylacetic acid (PubChem CID 119213913) has the molecular formula C12H19NO5S and a molecular weight of 289.35 g/mol. Its IUPAC name is 2-[(2-cyclopentylsulfonylacetyl)amino]-2-cyclopropylacetic acid.
| Compound Name | 2-[(2-cyclopentylsulfonylacetyl)amino]-2-cyclopropylacetic acid |
|---|---|
| PubChem CID | 119213913 |
| Molecular Formula | C12H19NO5S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2-[(2-cyclopentylsulfonylacetyl)amino]-2-cyclopropylacetic acid |
| SMILES | O=C(CS(=O)(=O)C1CCCC1)NC(C(=O)O)C1CC1 |
| InChI | InChI=1S/C12H19NO5S/c14-10(13-11(12(15)16)8-5-6-8)7-19(17,18)9-3-1-2-4-9/h8-9,11H,1-7H2,(H,13,14)(H,15,16) |
| InChIKey | IXDOWOLVLSBYJL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |