C18H31NO5S — CID 122056704
5-cyclohexyl-4-[(2-cyclopentylsulfonylacetyl)amino]pentanoic acid (PubChem CID 122056704) has the molecular formula C18H31NO5S and a molecular weight of 373.52 g/mol. Its IUPAC name is 5-cyclohexyl-4-[(2-cyclopentylsulfonylacetyl)amino]pentanoic acid.
| Compound Name | 5-cyclohexyl-4-[(2-cyclopentylsulfonylacetyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 122056704 |
| Molecular Formula | C18H31NO5S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 5-cyclohexyl-4-[(2-cyclopentylsulfonylacetyl)amino]pentanoic acid |
| SMILES | O=C(O)CCC(CC1CCCCC1)NC(=O)CS(=O)(=O)C1CCCC1 |
| InChI | InChI=1S/C18H31NO5S/c20-17(13-25(23,24)16-8-4-5-9-16)19-15(10-11-18(21)22)12-14-6-2-1-3-7-14/h14-16H,1-13H2,(H,19,20)(H,21,22) |
| InChIKey | OKDQWDJRUNNTAO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |