C16H29NO5S — CID 122056716
5-cyclohexyl-4-[(2-propylsulfonylacetyl)amino]pentanoic acid (PubChem CID 122056716) has the molecular formula C16H29NO5S and a molecular weight of 347.48 g/mol. Its IUPAC name is 5-cyclohexyl-4-[(2-propylsulfonylacetyl)amino]pentanoic acid.
| Compound Name | 5-cyclohexyl-4-[(2-propylsulfonylacetyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 122056716 |
| Molecular Formula | C16H29NO5S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 5-cyclohexyl-4-[(2-propylsulfonylacetyl)amino]pentanoic acid |
| SMILES | CCCS(=O)(=O)CC(=O)NC(CCC(=O)O)CC1CCCCC1 |
| InChI | InChI=1S/C16H29NO5S/c1-2-10-23(21,22)12-15(18)17-14(8-9-16(19)20)11-13-6-4-3-5-7-13/h13-14H,2-12H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | DJUBGXUPRVMULB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |