C16H24N2O4 — CID 122056791
5-cyclohexyl-4-[[2-(1,2-oxazol-3-yl)acetyl]amino]pentanoic acid (PubChem CID 122056791) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 5-cyclohexyl-4-[[2-(1,2-oxazol-3-yl)acetyl]amino]pentanoic acid.
| Compound Name | 5-cyclohexyl-4-[[2-(1,2-oxazol-3-yl)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 122056791 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 5-cyclohexyl-4-[[2-(1,2-oxazol-3-yl)acetyl]amino]pentanoic acid |
| SMILES | O=C(O)CCC(CC1CCCCC1)NC(=O)Cc1ccon1 |
| InChI | InChI=1S/C16H24N2O4/c19-15(11-14-8-9-22-18-14)17-13(6-7-16(20)21)10-12-4-2-1-3-5-12/h8-9,12-13H,1-7,10-11H2,(H,17,19)(H,20,21) |
| InChIKey | WYRJDLASHMIZDY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |