C18H26N2O3 — CID 122056442
5-cyclohexyl-4-[(6-methylpyridine-3-carbonyl)amino]pentanoic acid (PubChem CID 122056442) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 5-cyclohexyl-4-[(6-methylpyridine-3-carbonyl)amino]pentanoic acid.
| Compound Name | 5-cyclohexyl-4-[(6-methylpyridine-3-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 122056442 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 5-cyclohexyl-4-[(6-methylpyridine-3-carbonyl)amino]pentanoic acid |
| SMILES | Cc1ccc(C(=O)NC(CCC(=O)O)CC2CCCCC2)cn1 |
| InChI | InChI=1S/C18H26N2O3/c1-13-7-8-15(12-19-13)18(23)20-16(9-10-17(21)22)11-14-5-3-2-4-6-14/h7-8,12,14,16H,2-6,9-11H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | TWAWIGCBHRNFFA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |