C21H28N4O3 — CID 122056814
5-cyclohexyl-4-[[2-methyl-4-(1,2,4-triazol-1-yl)benzoyl]amino]pentanoic acid (PubChem CID 122056814) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is 5-cyclohexyl-4-[[2-methyl-4-(1,2,4-triazol-1-yl)benzoyl]amino]pentanoic acid.
| Compound Name | 5-cyclohexyl-4-[[2-methyl-4-(1,2,4-triazol-1-yl)benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 122056814 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 5-cyclohexyl-4-[[2-methyl-4-(1,2,4-triazol-1-yl)benzoyl]amino]pentanoic acid |
| SMILES | Cc1cc(-n2cncn2)ccc1C(=O)NC(CCC(=O)O)CC1CCCCC1 |
| InChI | InChI=1S/C21H28N4O3/c1-15-11-18(25-14-22-13-23-25)8-9-19(15)21(28)24-17(7-10-20(26)27)12-16-5-3-2-4-6-16/h8-9,11,13-14,16-17H,2-7,10,12H2,1H3,(H,24,28)(H,26,27) |
| InChIKey | YIDLFYMAQWBQMJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |