C22H31NO5 — CID 122056600
4-[[2-(5-acetyl-2-methoxyphenyl)acetyl]amino]-5-cyclohexylpentanoic acid (PubChem CID 122056600) has the molecular formula C22H31NO5 and a molecular weight of 389.49 g/mol. Its IUPAC name is 4-[[2-(5-acetyl-2-methoxyphenyl)acetyl]amino]-5-cyclohexylpentanoic acid.
| Compound Name | 4-[[2-(5-acetyl-2-methoxyphenyl)acetyl]amino]-5-cyclohexylpentanoic acid |
|---|---|
| PubChem CID | 122056600 |
| Molecular Formula | C22H31NO5 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 4-[[2-(5-acetyl-2-methoxyphenyl)acetyl]amino]-5-cyclohexylpentanoic acid |
| SMILES | COc1ccc(C(C)=O)cc1CC(=O)NC(CCC(=O)O)CC1CCCCC1 |
| InChI | InChI=1S/C22H31NO5/c1-15(24)17-8-10-20(28-2)18(13-17)14-21(25)23-19(9-11-22(26)27)12-16-6-4-3-5-7-16/h8,10,13,16,19H,3-7,9,11-12,14H2,1-2H3,(H,23,25)(H,26,27) |
| InChIKey | GGGAEKPHJLTZMB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |