C17H31NO5S — CID 122056936
4-[(2-tert-butylsulfonylacetyl)amino]-5-cyclohexylpentanoic acid (PubChem CID 122056936) has the molecular formula C17H31NO5S and a molecular weight of 361.50 g/mol. Its IUPAC name is 4-[(2-tert-butylsulfonylacetyl)amino]-5-cyclohexylpentanoic acid.
| Compound Name | 4-[(2-tert-butylsulfonylacetyl)amino]-5-cyclohexylpentanoic acid |
|---|---|
| PubChem CID | 122056936 |
| Molecular Formula | C17H31NO5S |
| Molecular Weight | 361.50 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 4-[(2-tert-butylsulfonylacetyl)amino]-5-cyclohexylpentanoic acid |
| SMILES | CC(C)(C)S(=O)(=O)CC(=O)NC(CCC(=O)O)CC1CCCCC1 |
| InChI | InChI=1S/C17H31NO5S/c1-17(2,3)24(22,23)12-15(19)18-14(9-10-16(20)21)11-13-7-5-4-6-8-13/h13-14H,4-12H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | IICHUVOKFYHYMG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |