C18H32N2O5S — CID 122056649
5-cyclohexyl-4-[(1-methylsulfonylpiperidine-4-carbonyl)amino]pentanoic acid (PubChem CID 122056649) has the molecular formula C18H32N2O5S and a molecular weight of 388.53 g/mol. Its IUPAC name is 5-cyclohexyl-4-[(1-methylsulfonylpiperidine-4-carbonyl)amino]pentanoic acid.
| Compound Name | 5-cyclohexyl-4-[(1-methylsulfonylpiperidine-4-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 122056649 |
| Molecular Formula | C18H32N2O5S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 5-cyclohexyl-4-[(1-methylsulfonylpiperidine-4-carbonyl)amino]pentanoic acid |
| SMILES | CS(=O)(=O)N1CCC(C(=O)NC(CCC(=O)O)CC2CCCCC2)CC1 |
| InChI | InChI=1S/C18H32N2O5S/c1-26(24,25)20-11-9-15(10-12-20)18(23)19-16(7-8-17(21)22)13-14-5-3-2-4-6-14/h14-16H,2-13H2,1H3,(H,19,23)(H,21,22) |
| InChIKey | FXYYLYJXMFSNLI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |