C17H25NO3S — CID 95338225
2-cyclopentylsulfonyl-N-[(1R)-1-(3,5-dimethylphenyl)ethyl]acetamide (PubChem CID 95338225) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is 2-cyclopentylsulfonyl-N-[(1R)-1-(3,5-dimethylphenyl)ethyl]acetamide.
| Compound Name | 2-cyclopentylsulfonyl-N-[(1R)-1-(3,5-dimethylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 95338225 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 2-cyclopentylsulfonyl-N-[(1R)-1-(3,5-dimethylphenyl)ethyl]acetamide |
| SMILES | Cc1cc(C)cc([C@@H](C)NC(=O)CS(=O)(=O)C2CCCC2)c1 |
| InChI | InChI=1S/C17H25NO3S/c1-12-8-13(2)10-15(9-12)14(3)18-17(19)11-22(20,21)16-6-4-5-7-16/h8-10,14,16H,4-7,11H2,1-3H3,(H,18,19)/t14-/m1/s1 |
| InChIKey | KRKLWQCEWZKITK-CQSZACIVSA-N |
| XLogP | 2.84 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |