C12H21NO5S — CID 119369506
(2R)-2-[(2-cyclopentylsulfonylacetyl)amino]-3-methylbutanoic acid (PubChem CID 119369506) has the molecular formula C12H21NO5S and a molecular weight of 291.37 g/mol. Its IUPAC name is (2R)-2-[(2-cyclopentylsulfonylacetyl)amino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[(2-cyclopentylsulfonylacetyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 119369506 |
| Molecular Formula | C12H21NO5S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (2R)-2-[(2-cyclopentylsulfonylacetyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)CS(=O)(=O)C1CCCC1)C(=O)O |
| InChI | InChI=1S/C12H21NO5S/c1-8(2)11(12(15)16)13-10(14)7-19(17,18)9-5-3-4-6-9/h8-9,11H,3-7H2,1-2H3,(H,13,14)(H,15,16)/t11-/m1/s1 |
| InChIKey | LWWACWVVUYEHJA-LLVKDONJSA-N |
| XLogP | 0.57 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |