C15H24N2O4 — CID 18605572
(3S)-3-amino-4-[[1-(dicyclopropylmethoxymethyl)cyclopropyl]amino]-4-oxobutanoic acid (PubChem CID 18605572) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is (3S)-3-amino-4-[[1-(dicyclopropylmethoxymethyl)cyclopropyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-4-[[1-(dicyclopropylmethoxymethyl)cyclopropyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18605572 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | (3S)-3-amino-4-[[1-(dicyclopropylmethoxymethyl)cyclopropyl]amino]-4-oxobutanoic acid |
| SMILES | N[C@@H](CC(=O)O)C(=O)NC1(COC(C2CC2)C2CC2)CC1 |
| InChI | InChI=1S/C15H24N2O4/c16-11(7-12(18)19)14(20)17-15(5-6-15)8-21-13(9-1-2-9)10-3-4-10/h9-11,13H,1-8,16H2,(H,17,20)(H,18,19)/t11-/m0/s1 |
| InChIKey | HNRKIDAPUVVBRM-NSHDSACASA-N |
| XLogP | 0.64 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |