C15H26N2O5S — CID 70446053
(3S,5R)-3,5-diamino-5-[(1-ethylcyclopentyl)sulfanylmethyl]-6-methoxy-4,6-dioxohexanoic acid (PubChem CID 70446053) has the molecular formula C15H26N2O5S and a molecular weight of 346.45 g/mol. Its IUPAC name is (3S,5R)-3,5-diamino-5-[(1-ethylcyclopentyl)sulfanylmethyl]-6-methoxy-4,6-dioxohexanoic acid.
| Compound Name | (3S,5R)-3,5-diamino-5-[(1-ethylcyclopentyl)sulfanylmethyl]-6-methoxy-4,6-dioxohexanoic acid |
|---|---|
| PubChem CID | 70446053 |
| Molecular Formula | C15H26N2O5S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (3S,5R)-3,5-diamino-5-[(1-ethylcyclopentyl)sulfanylmethyl]-6-methoxy-4,6-dioxohexanoic acid |
| SMILES | CCC1(SC[C@](N)(C(=O)OC)C(=O)[C@@H](N)CC(=O)O)CCCC1 |
| InChI | InChI=1S/C15H26N2O5S/c1-3-14(6-4-5-7-14)23-9-15(17,13(21)22-2)12(20)10(16)8-11(18)19/h10H,3-9,16-17H2,1-2H3,(H,18,19)/t10-,15+/m0/s1 |
| InChIKey | LHKLHEABSLIHBY-ZUZCIYMTSA-N |
| XLogP | 0.68 |
| TPSA | 132.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|