C13H24ClN3O4 — CID 139898343
(3S,5R)-3,5,6-triamino-5-(cyclohexylmethyl)-4,6-dioxohexanoic acid;hydrochloride (PubChem CID 139898343) has the molecular formula C13H24ClN3O4 and a molecular weight of 321.81 g/mol. Its IUPAC name is (3S,5R)-3,5,6-triamino-5-(cyclohexylmethyl)-4,6-dioxohexanoic acid;hydrochloride.
| Compound Name | (3S,5R)-3,5,6-triamino-5-(cyclohexylmethyl)-4,6-dioxohexanoic acid;hydrochloride |
|---|---|
| PubChem CID | 139898343 |
| Molecular Formula | C13H24ClN3O4 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | (3S,5R)-3,5,6-triamino-5-(cyclohexylmethyl)-4,6-dioxohexanoic acid;hydrochloride |
| SMILES | Cl.NC(=O)[C@@](N)(CC1CCCCC1)C(=O)[C@@H](N)CC(=O)O |
| InChI | InChI=1S/C13H23N3O4.ClH/c14-9(6-10(17)18)11(19)13(16,12(15)20)7-8-4-2-1-3-5-8;/h8-9H,1-7,14,16H2,(H2,15,20)(H,17,18);1H/t9-,13+;/m0./s1 |
| InChIKey | LFTWBZMXRREASI-BTJVGWIPSA-N |
| XLogP | -0.07 |
| TPSA | 149.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|