C14H23BrN2O4 — CID 174440853
(7S)-3,7-diamino-5-bromo-5-cyclohexyl-4,6-dioxooctanoic acid (PubChem CID 174440853) has the molecular formula C14H23BrN2O4 and a molecular weight of 363.25 g/mol. Its IUPAC name is (7S)-3,7-diamino-5-bromo-5-cyclohexyl-4,6-dioxooctanoic acid.
| Compound Name | (7S)-3,7-diamino-5-bromo-5-cyclohexyl-4,6-dioxooctanoic acid |
|---|---|
| PubChem CID | 174440853 |
| Molecular Formula | C14H23BrN2O4 |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | (7S)-3,7-diamino-5-bromo-5-cyclohexyl-4,6-dioxooctanoic acid |
| SMILES | C[C@H](N)C(=O)C(Br)(C(=O)C(N)CC(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C14H23BrN2O4/c1-8(16)12(20)14(15,9-5-3-2-4-6-9)13(21)10(17)7-11(18)19/h8-10H,2-7,16-17H2,1H3,(H,18,19)/t8-,10?,14?/m0/s1 |
| InChIKey | QHPXOOMZAVHUFS-BQDOLQKVSA-N |
| XLogP | 0.99 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|