C25H27F3N2O5 — CID 70413949
(Z)-2-[1-(butylamino)-2-oxo-2-[(1,1,1-trifluoro-2,3-diphenylpropan-2-yl)amino]ethyl]but-2-enedioic acid (PubChem CID 70413949) has the molecular formula C25H27F3N2O5 and a molecular weight of 492.49 g/mol. Its IUPAC name is (Z)-2-[1-(butylamino)-2-oxo-2-[(1,1,1-trifluoro-2,3-diphenylpropan-2-yl)amino]ethyl]but-2-enedioic acid.
| Compound Name | (Z)-2-[1-(butylamino)-2-oxo-2-[(1,1,1-trifluoro-2,3-diphenylpropan-2-yl)amino]ethyl]but-2-enedioic acid |
|---|---|
| PubChem CID | 70413949 |
| Molecular Formula | C25H27F3N2O5 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | (Z)-2-[1-(butylamino)-2-oxo-2-[(1,1,1-trifluoro-2,3-diphenylpropan-2-yl)amino]ethyl]but-2-enedioic acid |
| SMILES | CCCCNC(C(=O)NC(Cc1ccccc1)(c1ccccc1)C(F)(F)F)/C(=C/C(=O)O)C(=O)O |
| InChI | InChI=1S/C25H27F3N2O5/c1-2-3-14-29-21(19(23(34)35)15-20(31)32)22(33)30-24(25(26,27)28,18-12-8-5-9-13-18)16-17-10-6-4-7-11-17/h4-13,15,21,29H,2-3,14,16H2,1H3,(H,30,33)(H,31,32)(H,34,35)/b19-15- |
| InChIKey | VZRYOUMUWZLGEX-CYVLTUHYSA-N |
| XLogP | 3.66 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|