C40H40F6N2O6 — CID 118519712
bis[(5R)-1-amino-5-phenyl-5-[4-(trifluoromethyl)phenoxy]pentyl] (E)-but-2-enedioate (PubChem CID 118519712) has the molecular formula C40H40F6N2O6 and a molecular weight of 758.76 g/mol. Its IUPAC name is bis[(5R)-1-amino-5-phenyl-5-[4-(trifluoromethyl)phenoxy]pentyl] (E)-but-2-enedioate.
| Compound Name | bis[(5R)-1-amino-5-phenyl-5-[4-(trifluoromethyl)phenoxy]pentyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 118519712 |
| Molecular Formula | C40H40F6N2O6 |
| Molecular Weight | 758.76 g/mol |
| Exact Mass | 758.28 |
| IUPAC Name | bis[(5R)-1-amino-5-phenyl-5-[4-(trifluoromethyl)phenoxy]pentyl] (E)-but-2-enedioate |
| SMILES | NC(CCC[C@@H](Oc1ccc(C(F)(F)F)cc1)c1ccccc1)OC(=O)/C=C/C(=O)OC(N)CCC[C@@H](Oc1ccc(C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C40H40F6N2O6/c41-39(42,43)29-17-21-31(22-18-29)51-33(27-9-3-1-4-10-27)13-7-15-35(47)53-37(49)25-26-38(50)54-36(48)16-8-14-34(28-11-5-2-6-12-28)52-32-23-19-30(20-24-32)40(44,45)46/h1-6,9-12,17-26,33-36H,7-8,13-16,47-48H2/b26-25+/t33-,34-,35?,36?/m1/s1 |
| InChIKey | DFDHLWBWROVBEZ-PHZQPFACSA-N |
| XLogP | 9.22 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.76 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|