C13H22N2O2S — CID 83693955
tert-butyl N-(4-amino-2-thiophen-2-ylbutan-2-yl)carbamate (PubChem CID 83693955) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is tert-butyl N-(4-amino-2-thiophen-2-ylbutan-2-yl)carbamate.
| Compound Name | tert-butyl N-(4-amino-2-thiophen-2-ylbutan-2-yl)carbamate |
|---|---|
| PubChem CID | 83693955 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | tert-butyl N-(4-amino-2-thiophen-2-ylbutan-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C)(CCN)c1cccs1 |
| InChI | InChI=1S/C13H22N2O2S/c1-12(2,3)17-11(16)15-13(4,7-8-14)10-6-5-9-18-10/h5-6,9H,7-8,14H2,1-4H3,(H,15,16) |
| InChIKey | RUIDGXGTWAAWAM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |