C15H25NO3S — CID 110012268
tert-butyl 3-[(2-hydroxy-2-thiophen-2-ylpropyl)amino]butanoate (PubChem CID 110012268) has the molecular formula C15H25NO3S and a molecular weight of 299.44 g/mol. Its IUPAC name is tert-butyl 3-[(2-hydroxy-2-thiophen-2-ylpropyl)amino]butanoate.
| Compound Name | tert-butyl 3-[(2-hydroxy-2-thiophen-2-ylpropyl)amino]butanoate |
|---|---|
| PubChem CID | 110012268 |
| Molecular Formula | C15H25NO3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | tert-butyl 3-[(2-hydroxy-2-thiophen-2-ylpropyl)amino]butanoate |
| SMILES | CC(CC(=O)OC(C)(C)C)NCC(C)(O)c1cccs1 |
| InChI | InChI=1S/C15H25NO3S/c1-11(9-13(17)19-14(2,3)4)16-10-15(5,18)12-7-6-8-20-12/h6-8,11,16,18H,9-10H2,1-5H3 |
| InChIKey | PJAABGWRKRLYIF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |