C6H12N2O4S — CID 174953824
1-ethyl-2-methylimidazole;sulfuric acid (PubChem CID 174953824) has the molecular formula C6H12N2O4S and a molecular weight of 208.24 g/mol. Its IUPAC name is 1-ethyl-2-methylimidazole;sulfuric acid.
| Compound Name | 1-ethyl-2-methylimidazole;sulfuric acid |
|---|---|
| PubChem CID | 174953824 |
| Molecular Formula | C6H12N2O4S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 1-ethyl-2-methylimidazole;sulfuric acid |
| SMILES | CCn1ccnc1C.O=S(=O)(O)O |
| InChI | InChI=1S/C6H10N2.H2O4S/c1-3-8-5-4-7-6(8)2;1-5(2,3)4/h4-5H,3H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | WVFQSPSURLSODF-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|