C8H11F3N2O2 — CID 171928929
1-ethyl-2-methylimidazole;2,2,2-trifluoroacetic acid (PubChem CID 171928929) has the molecular formula C8H11F3N2O2 and a molecular weight of 224.18 g/mol. Its IUPAC name is 1-ethyl-2-methylimidazole;2,2,2-trifluoroacetic acid.
| Compound Name | 1-ethyl-2-methylimidazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171928929 |
| Molecular Formula | C8H11F3N2O2 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 1-ethyl-2-methylimidazole;2,2,2-trifluoroacetic acid |
| SMILES | CCn1ccnc1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C6H10N2.C2HF3O2/c1-3-8-5-4-7-6(8)2;3-2(4,5)1(6)7/h4-5H,3H2,1-2H3;(H,6,7) |
| InChIKey | QHWLHACNKRYVHH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |