C10H17N3O2 — CID 62818569
2-[(1-ethylimidazol-2-yl)-methylamino]-2-methylpropanoic acid (PubChem CID 62818569) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-[(1-ethylimidazol-2-yl)-methylamino]-2-methylpropanoic acid.
| Compound Name | 2-[(1-ethylimidazol-2-yl)-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 62818569 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 2-[(1-ethylimidazol-2-yl)-methylamino]-2-methylpropanoic acid |
| SMILES | CCn1ccnc1N(C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C10H17N3O2/c1-5-13-7-6-11-9(13)12(4)10(2,3)8(14)15/h6-7H,5H2,1-4H3,(H,14,15) |
| InChIKey | SSTDLNYOGXGWNX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |