C14H20N3O2- — CID 86647529
2-(4-methylpiperazin-1-yl)-2-pyridin-2-ylbutanoate (PubChem CID 86647529) has the molecular formula C14H20N3O2- and a molecular weight of 262.33 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-2-pyridin-2-ylbutanoate.
| Compound Name | 2-(4-methylpiperazin-1-yl)-2-pyridin-2-ylbutanoate |
|---|---|
| PubChem CID | 86647529 |
| Molecular Formula | C14H20N3O2- |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-2-pyridin-2-ylbutanoate |
| SMILES | CCC(C(=O)[O-])(c1ccccn1)N1CCN(C)CC1 |
| InChI | InChI=1S/C14H21N3O2/c1-3-14(13(18)19,12-6-4-5-7-15-12)17-10-8-16(2)9-11-17/h4-7H,3,8-11H2,1-2H3,(H,18,19)/p-1 |
| InChIKey | YYJDAQOVQXGQFV-UHFFFAOYSA-M |
| XLogP | -0.32 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |