C16H18N2O3S2 — CID 71290427
(2R)-2-[(2-methyl-2-phenylpropanoyl)amino]-3-(1,3-thiazol-2-ylsulfanyl)propanoic acid (PubChem CID 71290427) has the molecular formula C16H18N2O3S2 and a molecular weight of 350.47 g/mol. Its IUPAC name is (2R)-2-[(2-methyl-2-phenylpropanoyl)amino]-3-(1,3-thiazol-2-ylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-[(2-methyl-2-phenylpropanoyl)amino]-3-(1,3-thiazol-2-ylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 71290427 |
| Molecular Formula | C16H18N2O3S2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | (2R)-2-[(2-methyl-2-phenylpropanoyl)amino]-3-(1,3-thiazol-2-ylsulfanyl)propanoic acid |
| SMILES | CC(C)(C(=O)N[C@@H](CSc1nccs1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H18N2O3S2/c1-16(2,11-6-4-3-5-7-11)14(21)18-12(13(19)20)10-23-15-17-8-9-22-15/h3-9,12H,10H2,1-2H3,(H,18,21)(H,19,20)/t12-/m0/s1 |
| InChIKey | XQOWEPRPSQMJMS-LBPRGKRZSA-N |
| XLogP | 2.78 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|