C13H18N2S2 — CID 174963033
tert-butylbenzene;S-(1,3-thiazol-2-yl)thiohydroxylamine (PubChem CID 174963033) has the molecular formula C13H18N2S2 and a molecular weight of 266.44 g/mol. Its IUPAC name is tert-butylbenzene;S-(1,3-thiazol-2-yl)thiohydroxylamine.
| Compound Name | tert-butylbenzene;S-(1,3-thiazol-2-yl)thiohydroxylamine |
|---|---|
| PubChem CID | 174963033 |
| Molecular Formula | C13H18N2S2 |
| Molecular Weight | 266.44 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | tert-butylbenzene;S-(1,3-thiazol-2-yl)thiohydroxylamine |
| SMILES | CC(C)(C)c1ccccc1.NSc1nccs1 |
| InChI | InChI=1S/C10H14.C3H4N2S2/c1-10(2,3)9-7-5-4-6-8-9;4-7-3-5-1-2-6-3/h4-8H,1-3H3;1-2H,4H2 |
| InChIKey | OJOSXTLZQJSFJQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|