C8H14N2S2 — CID 64626494
N-methyl-1-(1,3-thiazol-2-ylsulfanyl)butan-2-amine (PubChem CID 64626494) has the molecular formula C8H14N2S2 and a molecular weight of 202.35 g/mol. Its IUPAC name is N-methyl-1-(1,3-thiazol-2-ylsulfanyl)butan-2-amine.
| Compound Name | N-methyl-1-(1,3-thiazol-2-ylsulfanyl)butan-2-amine |
|---|---|
| PubChem CID | 64626494 |
| Molecular Formula | C8H14N2S2 |
| Molecular Weight | 202.35 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | N-methyl-1-(1,3-thiazol-2-ylsulfanyl)butan-2-amine |
| SMILES | CCC(CSc1nccs1)NC |
| InChI | InChI=1S/C8H14N2S2/c1-3-7(9-2)6-12-8-10-4-5-11-8/h4-5,7,9H,3,6H2,1-2H3 |
| InChIKey | CMYNDEIWGFEIAA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|