C16H22N2OS2 — CID 64627916
N-[1-(2-methoxy-5-methylphenyl)-2-(1,3-thiazol-2-ylsulfanyl)ethyl]propan-1-amine (PubChem CID 64627916) has the molecular formula C16H22N2OS2 and a molecular weight of 322.50 g/mol. Its IUPAC name is N-[1-(2-methoxy-5-methylphenyl)-2-(1,3-thiazol-2-ylsulfanyl)ethyl]propan-1-amine.
| Compound Name | N-[1-(2-methoxy-5-methylphenyl)-2-(1,3-thiazol-2-ylsulfanyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 64627916 |
| Molecular Formula | C16H22N2OS2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | N-[1-(2-methoxy-5-methylphenyl)-2-(1,3-thiazol-2-ylsulfanyl)ethyl]propan-1-amine |
| SMILES | CCCNC(CSc1nccs1)c1cc(C)ccc1OC |
| InChI | InChI=1S/C16H22N2OS2/c1-4-7-17-14(11-21-16-18-8-9-20-16)13-10-12(2)5-6-15(13)19-3/h5-6,8-10,14,17H,4,7,11H2,1-3H3 |
| InChIKey | LPWGBNPBDOFZBY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|