C10H13N3S3 — CID 115635490
N-(1,3-thiazol-4-ylmethyl)-3-(1,3-thiazol-2-ylsulfanyl)propan-1-amine (PubChem CID 115635490) has the molecular formula C10H13N3S3 and a molecular weight of 271.44 g/mol. Its IUPAC name is N-(1,3-thiazol-4-ylmethyl)-3-(1,3-thiazol-2-ylsulfanyl)propan-1-amine.
| Compound Name | N-(1,3-thiazol-4-ylmethyl)-3-(1,3-thiazol-2-ylsulfanyl)propan-1-amine |
|---|---|
| PubChem CID | 115635490 |
| Molecular Formula | C10H13N3S3 |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | N-(1,3-thiazol-4-ylmethyl)-3-(1,3-thiazol-2-ylsulfanyl)propan-1-amine |
| SMILES | c1csc(SCCCNCc2cscn2)n1 |
| InChI | InChI=1S/C10H13N3S3/c1(4-15-10-12-3-5-16-10)2-11-6-9-7-14-8-13-9/h3,5,7-8,11H,1-2,4,6H2 |
| InChIKey | UJGGVLCLKHCISB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|