C12H17Cl2N3 — CID 45123702
4-[(3,5-dimethylpyrazol-1-yl)methyl]aniline;dihydrochloride (PubChem CID 45123702) has the molecular formula C12H17Cl2N3 and a molecular weight of 274.20 g/mol. Its IUPAC name is 4-[(3,5-dimethylpyrazol-1-yl)methyl]aniline;dihydrochloride.
| Compound Name | 4-[(3,5-dimethylpyrazol-1-yl)methyl]aniline;dihydrochloride |
|---|---|
| PubChem CID | 45123702 |
| Molecular Formula | C12H17Cl2N3 |
| Molecular Weight | 274.20 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 4-[(3,5-dimethylpyrazol-1-yl)methyl]aniline;dihydrochloride |
| SMILES | Cc1cc(C)n(Cc2ccc(N)cc2)n1.Cl.Cl |
| InChI | InChI=1S/C12H15N3.2ClH/c1-9-7-10(2)15(14-9)8-11-3-5-12(13)6-4-11;;/h3-7H,8,13H2,1-2H3;2*1H |
| InChIKey | ACMFNEADGQXGJL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.20 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|