About [2-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]phenyl]methanamine
[2-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]phenyl]methanamine (PubChem CID 16792269) has the molecular formula C19H21N3
and a molecular weight of 291.40 g/mol. Its IUPAC name is [2-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]phenyl]methanamine.
Molecular Properties
| Compound Name | [2-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]phenyl]methanamine |
| PubChem CID | 16792269 |
| Molecular Formula | C19H21N3 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | [2-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]phenyl]methanamine |
| SMILES | Cc1cc(C)n(Cc2ccc(-c3ccccc3CN)cc2)n1 |
| InChI | InChI=1S/C19H21N3/c1-14-11-15(2)22(21-14)13-16-7-9-17(10-8-16)19-6-4-3-5-18(19)12-20/h3-11H,12-13,20H2,1-2H3 |
| InChIKey | RFVHYMXCBASOTN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]phenyl]methanamine?
The IUPAC name of [2-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]phenyl]methanamine (CID 16792269) is [2-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]phenyl]methanamine.
What is the SMILES notation for [2-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]phenyl]methanamine?
The canonical SMILES for [2-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]phenyl]methanamine is Cc1cc(C)n(Cc2ccc(-c3ccccc3CN)cc2)n1.
What is the InChIKey of [2-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]phenyl]methanamine?
The InChIKey is RFVHYMXCBASOTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3/c1-14-11-15(2)22(21-14)13-16-7-9-17(10-8-16)19-6-4-3-5-18(19)12-20/h3-11H,12-13,20H2,1-2H3.
What are the key properties of [2-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]phenyl]methanamine?
[2-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]phenyl]methanamine has a molecular weight of 291.40 g/mol, XLogP of 3.67, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]phenyl]methanamine is sourced from PubChem (CID 16792269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).