C15H16N2O2 — CID 109375502
(E)-3-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]prop-2-enoic acid (PubChem CID 109375502) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is (E)-3-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 109375502 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | (E)-3-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]prop-2-enoic acid |
| SMILES | Cc1cc(C)n(Cc2ccc(/C=C/C(=O)O)cc2)n1 |
| InChI | InChI=1S/C15H16N2O2/c1-11-9-12(2)17(16-11)10-14-5-3-13(4-6-14)7-8-15(18)19/h3-9H,10H2,1-2H3,(H,18,19)/b8-7+ |
| InChIKey | DVZFIOLOHZUQRN-BQYQJAHWSA-N |
| XLogP | 2.65 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|