C16H18N4O2 — CID 40724083
(E)-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-phenylprop-2-enehydrazide (PubChem CID 40724083) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is (E)-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-phenylprop-2-enehydrazide.
| Compound Name | (E)-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-phenylprop-2-enehydrazide |
|---|---|
| PubChem CID | 40724083 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (E)-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-phenylprop-2-enehydrazide |
| SMILES | Cc1cc(C)n(CC(=O)NNC(=O)/C=C/c2ccccc2)n1 |
| InChI | InChI=1S/C16H18N4O2/c1-12-10-13(2)20(19-12)11-16(22)18-17-15(21)9-8-14-6-4-3-5-7-14/h3-10H,11H2,1-2H3,(H,17,21)(H,18,22)/b9-8+ |
| InChIKey | DBMGZHJFBCJDKK-CMDGGOBGSA-N |
| XLogP | 1.36 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|