C10H12N2O — CID 83183212
1-(furan-3-ylmethyl)-3,5-dimethylpyrazole (PubChem CID 83183212) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 1-(furan-3-ylmethyl)-3,5-dimethylpyrazole.
| Compound Name | 1-(furan-3-ylmethyl)-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 83183212 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 1-(furan-3-ylmethyl)-3,5-dimethylpyrazole |
| SMILES | Cc1cc(C)n(Cc2ccoc2)n1 |
| InChI | InChI=1S/C10H12N2O/c1-8-5-9(2)12(11-8)6-10-3-4-13-7-10/h3-5,7H,6H2,1-2H3 |
| InChIKey | MCTGDWLNIUCOIP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |