C17H26ClN7O — CID 168603557
2-[3-chloro-4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]-1-(diaminomethylidene)guanidine (PubChem CID 168603557) has the molecular formula C17H26ClN7O and a molecular weight of 379.90 g/mol. Its IUPAC name is 2-[3-chloro-4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]-1-(diaminomethylidene)guanidine.
| Compound Name | 2-[3-chloro-4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168603557 |
| Molecular Formula | C17H26ClN7O |
| Molecular Weight | 379.90 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 2-[3-chloro-4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]-1-(diaminomethylidene)guanidine |
| SMILES | CC(C)CC(=O)N1CCN(c2ccc(/N=C(\N)N=C(N)N)cc2Cl)CC1 |
| InChI | InChI=1S/C17H26ClN7O/c1-11(2)9-15(26)25-7-5-24(6-8-25)14-4-3-12(10-13(14)18)22-17(21)23-16(19)20/h3-4,10-11H,5-9H2,1-2H3,(H6,19,20,21,22,23) |
| InChIKey | WDMNCBHRDYNSNM-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 126.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.90 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|